C18H20Cl2N2O4S — CID 10598780
(2S)-2-[benzyl-(2,5-dichlorophenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide (PubChem CID 10598780) has the molecular formula C18H20Cl2N2O4S and a molecular weight of 431.34 g/mol. Its IUPAC name is (2S)-2-[benzyl-(2,5-dichlorophenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide.
| Compound Name | (2S)-2-[benzyl-(2,5-dichlorophenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 10598780 |
| Molecular Formula | C18H20Cl2N2O4S |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | (2S)-2-[benzyl-(2,5-dichlorophenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide |
| SMILES | CC(C)[C@@H](C(=O)NO)N(Cc1ccccc1)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H20Cl2N2O4S/c1-12(2)17(18(23)21-24)22(11-13-6-4-3-5-7-13)27(25,26)16-10-14(19)8-9-15(16)20/h3-10,12,17,24H,11H2,1-2H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | SNQNALAVHNVVAH-KRWDZBQOSA-N |
| XLogP | 3.71 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|