C14H13Cl2NO5S — CID 50894753
2-[(2,5-dichlorophenyl)sulfonyl-(furan-2-ylmethyl)amino]propanoic acid (PubChem CID 50894753) has the molecular formula C14H13Cl2NO5S and a molecular weight of 378.23 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)sulfonyl-(furan-2-ylmethyl)amino]propanoic acid.
| Compound Name | 2-[(2,5-dichlorophenyl)sulfonyl-(furan-2-ylmethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 50894753 |
| Molecular Formula | C14H13Cl2NO5S |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)sulfonyl-(furan-2-ylmethyl)amino]propanoic acid |
| SMILES | CC(C(=O)O)N(Cc1ccco1)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H13Cl2NO5S/c1-9(14(18)19)17(8-11-3-2-6-22-11)23(20,21)13-7-10(15)4-5-12(13)16/h2-7,9H,8H2,1H3,(H,18,19) |
| InChIKey | DDCRJTPSBXPQFU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |