C15H16ClNO4S — CID 50894365
2-[furan-2-ylmethyl-(4-methylphenyl)sulfonylamino]propanoyl chloride (PubChem CID 50894365) has the molecular formula C15H16ClNO4S and a molecular weight of 341.82 g/mol. Its IUPAC name is 2-[furan-2-ylmethyl-(4-methylphenyl)sulfonylamino]propanoyl chloride.
| Compound Name | 2-[furan-2-ylmethyl-(4-methylphenyl)sulfonylamino]propanoyl chloride |
|---|---|
| PubChem CID | 50894365 |
| Molecular Formula | C15H16ClNO4S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-[furan-2-ylmethyl-(4-methylphenyl)sulfonylamino]propanoyl chloride |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccco2)C(C)C(=O)Cl)cc1 |
| InChI | InChI=1S/C15H16ClNO4S/c1-11-5-7-14(8-6-11)22(19,20)17(12(2)15(16)18)10-13-4-3-9-21-13/h3-9,12H,10H2,1-2H3 |
| InChIKey | NOPFMHWWBKOHHZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|