C20H22ClNO4S — CID 35299124
methyl 3-[benzyl-[(1S)-1-cyclopropylethyl]sulfamoyl]-4-chlorobenzoate (PubChem CID 35299124) has the molecular formula C20H22ClNO4S and a molecular weight of 407.92 g/mol. Its IUPAC name is methyl 3-[benzyl-[(1S)-1-cyclopropylethyl]sulfamoyl]-4-chlorobenzoate.
| Compound Name | methyl 3-[benzyl-[(1S)-1-cyclopropylethyl]sulfamoyl]-4-chlorobenzoate |
|---|---|
| PubChem CID | 35299124 |
| Molecular Formula | C20H22ClNO4S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | methyl 3-[benzyl-[(1S)-1-cyclopropylethyl]sulfamoyl]-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(S(=O)(=O)N(Cc2ccccc2)[C@@H](C)C2CC2)c1 |
| InChI | InChI=1S/C20H22ClNO4S/c1-14(16-8-9-16)22(13-15-6-4-3-5-7-15)27(24,25)19-12-17(20(23)26-2)10-11-18(19)21/h3-7,10-12,14,16H,8-9,13H2,1-2H3/t14-/m0/s1 |
| InChIKey | KVRZIPLUYZJHEI-AWEZNQCLSA-N |
| XLogP | 4.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |