C23H27ClN2O4S — CID 75854481
N-benzyl-4-chloro-N-(1-cyclopropylethyl)-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 75854481) has the molecular formula C23H27ClN2O4S and a molecular weight of 463.00 g/mol. Its IUPAC name is N-benzyl-4-chloro-N-(1-cyclopropylethyl)-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-benzyl-4-chloro-N-(1-cyclopropylethyl)-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 75854481 |
| Molecular Formula | C23H27ClN2O4S |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | N-benzyl-4-chloro-N-(1-cyclopropylethyl)-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CC(C1CC1)N(Cc1ccccc1)C(=O)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C23H27ClN2O4S/c1-17(19-7-8-19)26(16-18-5-3-2-4-6-18)23(27)20-9-10-21(24)22(15-20)31(28,29)25-11-13-30-14-12-25/h2-6,9-10,15,17,19H,7-8,11-14,16H2,1H3 |
| InChIKey | AONFGJRVSSRYFK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |