C19H20ClNO — CID 92643816
N-benzyl-4-chloro-N-[(1S)-1-cyclopropylethyl]benzamide (PubChem CID 92643816) has the molecular formula C19H20ClNO and a molecular weight of 313.83 g/mol. Its IUPAC name is N-benzyl-4-chloro-N-[(1S)-1-cyclopropylethyl]benzamide.
| Compound Name | N-benzyl-4-chloro-N-[(1S)-1-cyclopropylethyl]benzamide |
|---|---|
| PubChem CID | 92643816 |
| Molecular Formula | C19H20ClNO |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-benzyl-4-chloro-N-[(1S)-1-cyclopropylethyl]benzamide |
| SMILES | C[C@@H](C1CC1)N(Cc1ccccc1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClNO/c1-14(16-7-8-16)21(13-15-5-3-2-4-6-15)19(22)17-9-11-18(20)12-10-17/h2-6,9-12,14,16H,7-8,13H2,1H3/t14-/m0/s1 |
| InChIKey | QLYOFYAIGOAWEE-AWEZNQCLSA-N |
| XLogP | 4.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |