C20H21Cl2NO — CID 6990705
N-benzyl-2,4-dichloro-N-[(1S)-1-cyclopropylethyl]-5-methylbenzamide (PubChem CID 6990705) has the molecular formula C20H21Cl2NO and a molecular weight of 362.30 g/mol. Its IUPAC name is N-benzyl-2,4-dichloro-N-[(1S)-1-cyclopropylethyl]-5-methylbenzamide.
| Compound Name | N-benzyl-2,4-dichloro-N-[(1S)-1-cyclopropylethyl]-5-methylbenzamide |
|---|---|
| PubChem CID | 6990705 |
| Molecular Formula | C20H21Cl2NO |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-benzyl-2,4-dichloro-N-[(1S)-1-cyclopropylethyl]-5-methylbenzamide |
| SMILES | Cc1cc(C(=O)N(Cc2ccccc2)[C@@H](C)C2CC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H21Cl2NO/c1-13-10-17(19(22)11-18(13)21)20(24)23(14(2)16-8-9-16)12-15-6-4-3-5-7-15/h3-7,10-11,14,16H,8-9,12H2,1-2H3/t14-/m0/s1 |
| InChIKey | YFOQQGPVQCOXPU-AWEZNQCLSA-N |
| XLogP | 5.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |