C17H24ClNO — CID 60948375
N-benzyl-5-chloro-N-(1-cyclopropylethyl)pentanamide (PubChem CID 60948375) has the molecular formula C17H24ClNO and a molecular weight of 293.84 g/mol. Its IUPAC name is N-benzyl-5-chloro-N-(1-cyclopropylethyl)pentanamide.
| Compound Name | N-benzyl-5-chloro-N-(1-cyclopropylethyl)pentanamide |
|---|---|
| PubChem CID | 60948375 |
| Molecular Formula | C17H24ClNO |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-benzyl-5-chloro-N-(1-cyclopropylethyl)pentanamide |
| SMILES | CC(C1CC1)N(Cc1ccccc1)C(=O)CCCCCl |
| InChI | InChI=1S/C17H24ClNO/c1-14(16-10-11-16)19(17(20)9-5-6-12-18)13-15-7-3-2-4-8-15/h2-4,7-8,14,16H,5-6,9-13H2,1H3 |
| InChIKey | CLRZORVDSQHMTB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|