C13H17ClN2O4S — CID 1092795
4-chloro-N,N-dimethyl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 1092795) has the molecular formula C13H17ClN2O4S and a molecular weight of 332.81 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N,N-dimethyl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 1092795 |
| Molecular Formula | C13H17ClN2O4S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 4-chloro-N,N-dimethyl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C13H17ClN2O4S/c1-15(2)13(17)10-3-4-11(14)12(9-10)21(18,19)16-5-7-20-8-6-16/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | HQGJWFKUAZQJTO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |