C19H29ClN2O5S — CID 55664196
4-chloro-N-(2-methoxyethyl)-3-morpholin-4-ylsulfonyl-N-pentan-3-ylbenzamide (PubChem CID 55664196) has the molecular formula C19H29ClN2O5S and a molecular weight of 432.97 g/mol. Its IUPAC name is 4-chloro-N-(2-methoxyethyl)-3-morpholin-4-ylsulfonyl-N-pentan-3-ylbenzamide.
| Compound Name | 4-chloro-N-(2-methoxyethyl)-3-morpholin-4-ylsulfonyl-N-pentan-3-ylbenzamide |
|---|---|
| PubChem CID | 55664196 |
| Molecular Formula | C19H29ClN2O5S |
| Molecular Weight | 432.97 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 4-chloro-N-(2-methoxyethyl)-3-morpholin-4-ylsulfonyl-N-pentan-3-ylbenzamide |
| SMILES | CCC(CC)N(CCOC)C(=O)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H29ClN2O5S/c1-4-16(5-2)22(10-11-26-3)19(23)15-6-7-17(20)18(14-15)28(24,25)21-8-12-27-13-9-21/h6-7,14,16H,4-5,8-13H2,1-3H3 |
| InChIKey | UMGBOZBVOIIAGA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.97 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |