C18H27FN2O5S — CID 55589792
4-fluoro-N-(2-methoxyethyl)-N-(2-methylpropyl)-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 55589792) has the molecular formula C18H27FN2O5S and a molecular weight of 402.49 g/mol. Its IUPAC name is 4-fluoro-N-(2-methoxyethyl)-N-(2-methylpropyl)-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 4-fluoro-N-(2-methoxyethyl)-N-(2-methylpropyl)-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55589792 |
| Molecular Formula | C18H27FN2O5S |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 4-fluoro-N-(2-methoxyethyl)-N-(2-methylpropyl)-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | COCCN(CC(C)C)C(=O)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H27FN2O5S/c1-14(2)13-20(6-9-25-3)18(22)15-4-5-16(19)17(12-15)27(23,24)21-7-10-26-11-8-21/h4-5,12,14H,6-11,13H2,1-3H3 |
| InChIKey | JNJNPNHDOPSYAA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |