C15H23ClN4O4S — CID 18727164
(2R)-2-[[4-(4-chlorophenyl)piperazin-1-yl]sulfonylamino]-N-hydroxypentanamide (PubChem CID 18727164) has the molecular formula C15H23ClN4O4S and a molecular weight of 390.89 g/mol. Its IUPAC name is (2R)-2-[[4-(4-chlorophenyl)piperazin-1-yl]sulfonylamino]-N-hydroxypentanamide.
| Compound Name | (2R)-2-[[4-(4-chlorophenyl)piperazin-1-yl]sulfonylamino]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 18727164 |
| Molecular Formula | C15H23ClN4O4S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (2R)-2-[[4-(4-chlorophenyl)piperazin-1-yl]sulfonylamino]-N-hydroxypentanamide |
| SMILES | CCC[C@@H](NS(=O)(=O)N1CCN(c2ccc(Cl)cc2)CC1)C(=O)NO |
| InChI | InChI=1S/C15H23ClN4O4S/c1-2-3-14(15(21)17-22)18-25(23,24)20-10-8-19(9-11-20)13-6-4-12(16)5-7-13/h4-7,14,18,22H,2-3,8-11H2,1H3,(H,17,21)/t14-/m1/s1 |
| InChIKey | OSRPJWLCUYFDAR-CQSZACIVSA-N |
| XLogP | 0.97 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|