C13H20ClN5O4S — CID 139983361
(2R)-2-[[4-(5-chloro-2-pyridinyl)piperazin-1-yl]sulfonylamino]-N-hydroxybutanamide (PubChem CID 139983361) has the molecular formula C13H20ClN5O4S and a molecular weight of 377.85 g/mol. Its IUPAC name is (2R)-2-[[4-(5-chloro-2-pyridinyl)piperazin-1-yl]sulfonylamino]-N-hydroxybutanamide.
| Compound Name | (2R)-2-[[4-(5-chloro-2-pyridinyl)piperazin-1-yl]sulfonylamino]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 139983361 |
| Molecular Formula | C13H20ClN5O4S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (2R)-2-[[4-(5-chloro-2-pyridinyl)piperazin-1-yl]sulfonylamino]-N-hydroxybutanamide |
| SMILES | CC[C@@H](NS(=O)(=O)N1CCN(c2ccc(Cl)cn2)CC1)C(=O)NO |
| InChI | InChI=1S/C13H20ClN5O4S/c1-2-11(13(20)16-21)17-24(22,23)19-7-5-18(6-8-19)12-4-3-10(14)9-15-12/h3-4,9,11,17,21H,2,5-8H2,1H3,(H,16,20)/t11-/m1/s1 |
| InChIKey | KOUOXXGDJWCWLD-LLVKDONJSA-N |
| XLogP | -0.02 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|