C13H19ClN4S — CID 63342498
2-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]butanethioamide (PubChem CID 63342498) has the molecular formula C13H19ClN4S and a molecular weight of 298.84 g/mol. Its IUPAC name is 2-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]butanethioamide.
| Compound Name | 2-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]butanethioamide |
|---|---|
| PubChem CID | 63342498 |
| Molecular Formula | C13H19ClN4S |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]butanethioamide |
| SMILES | CCC(C(N)=S)N1CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C13H19ClN4S/c1-2-11(13(15)19)17-5-7-18(8-6-17)12-4-3-10(14)9-16-12/h3-4,9,11H,2,5-8H2,1H3,(H2,15,19) |
| InChIKey | VZVIGRYWZPDNJJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|