C17H19ClN4O — CID 95587281
(2R)-2-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-2-phenylacetamide (PubChem CID 95587281) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is (2R)-2-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-2-phenylacetamide.
| Compound Name | (2R)-2-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 95587281 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (2R)-2-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-2-phenylacetamide |
| SMILES | NC(=O)[C@@H](c1ccccc1)N1CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C17H19ClN4O/c18-14-6-7-15(20-12-14)21-8-10-22(11-9-21)16(17(19)23)13-4-2-1-3-5-13/h1-7,12,16H,8-11H2,(H2,19,23)/t16-/m1/s1 |
| InChIKey | QDZUHIVPVSHHBZ-MRXNPFEDSA-N |
| XLogP | 2.08 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |