C14H19Cl2N3O3S — CID 41349884
2-chloro-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylethyl]acetamide (PubChem CID 41349884) has the molecular formula C14H19Cl2N3O3S and a molecular weight of 380.30 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylethyl]acetamide.
| Compound Name | 2-chloro-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylethyl]acetamide |
|---|---|
| PubChem CID | 41349884 |
| Molecular Formula | C14H19Cl2N3O3S |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 2-chloro-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylethyl]acetamide |
| SMILES | O=C(CCl)NCCS(=O)(=O)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C14H19Cl2N3O3S/c15-11-14(20)17-5-10-23(21,22)19-8-6-18(7-9-19)13-3-1-12(16)2-4-13/h1-4H,5-11H2,(H,17,20) |
| InChIKey | XOVRISWFUKQXSR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|