C19H20Cl2N4O5S — CID 41349933
4-chloro-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylethyl]-3-nitrobenzamide (PubChem CID 41349933) has the molecular formula C19H20Cl2N4O5S and a molecular weight of 487.37 g/mol. Its IUPAC name is 4-chloro-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylethyl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 41349933 |
| Molecular Formula | C19H20Cl2N4O5S |
| Molecular Weight | 487.37 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | 4-chloro-N-[2-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylethyl]-3-nitrobenzamide |
| SMILES | O=C(NCCS(=O)(=O)N1CCN(c2ccc(Cl)cc2)CC1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20Cl2N4O5S/c20-15-2-4-16(5-3-15)23-8-10-24(11-9-23)31(29,30)12-7-22-19(26)14-1-6-17(21)18(13-14)25(27)28/h1-6,13H,7-12H2,(H,22,26) |
| InChIKey | GMGZTQAAMTWBMN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|