C21H25ClN4O5S — CID 2096279
(2R)-2-[(4-chlorophenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)pentanediamide (PubChem CID 2096279) has the molecular formula C21H25ClN4O5S and a molecular weight of 480.97 g/mol. Its IUPAC name is (2R)-2-[(4-chlorophenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)pentanediamide.
| Compound Name | (2R)-2-[(4-chlorophenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)pentanediamide |
|---|---|
| PubChem CID | 2096279 |
| Molecular Formula | C21H25ClN4O5S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | (2R)-2-[(4-chlorophenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)pentanediamide |
| SMILES | NC(=O)CC[C@@H](NS(=O)(=O)c1ccc(Cl)cc1)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H25ClN4O5S/c22-15-1-7-18(8-2-15)32(29,30)25-19(9-10-20(23)27)21(28)24-16-3-5-17(6-4-16)26-11-13-31-14-12-26/h1-8,19,25H,9-14H2,(H2,23,27)(H,24,28)/t19-/m1/s1 |
| InChIKey | RXWSXLFKWWYPJM-LJQANCHMSA-N |
| XLogP | 1.73 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|