C30H33N5O6S2 — CID 155168971
2-[(4-methylphenyl)sulfonylamino]-3-[1-(4-methylphenyl)sulfonylimidazol-4-yl]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 155168971) has the molecular formula C30H33N5O6S2 and a molecular weight of 623.76 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylamino]-3-[1-(4-methylphenyl)sulfonylimidazol-4-yl]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | 2-[(4-methylphenyl)sulfonylamino]-3-[1-(4-methylphenyl)sulfonylimidazol-4-yl]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 155168971 |
| Molecular Formula | C30H33N5O6S2 |
| Molecular Weight | 623.76 g/mol |
| Exact Mass | 623.19 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylamino]-3-[1-(4-methylphenyl)sulfonylimidazol-4-yl]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(Cc2cn(S(=O)(=O)c3ccc(C)cc3)cn2)C(=O)Nc2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C30H33N5O6S2/c1-22-3-11-27(12-4-22)42(37,38)33-29(30(36)32-24-7-9-26(10-8-24)34-15-17-41-18-16-34)19-25-20-35(21-31-25)43(39,40)28-13-5-23(2)6-14-28/h3-14,20-21,29,33H,15-19H2,1-2H3,(H,32,36) |
| InChIKey | KJLLQJLCOITJIN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.76 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|