C42H50N6O12S2 — CID 160716542
(3S)-3-[(4-methylphenyl)sulfonylamino]-4-(4-morpholin-4-ylanilino)-4-oxobutanoic acid (PubChem CID 160716542) has the molecular formula C42H50N6O12S2 and a molecular weight of 895.03 g/mol. Its IUPAC name is (3S)-3-[(4-methylphenyl)sulfonylamino]-4-(4-morpholin-4-ylanilino)-4-oxobutanoic acid.
| Compound Name | (3S)-3-[(4-methylphenyl)sulfonylamino]-4-(4-morpholin-4-ylanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 160716542 |
| Molecular Formula | C42H50N6O12S2 |
| Molecular Weight | 895.03 g/mol |
| Exact Mass | 894.29 |
| IUPAC Name | (3S)-3-[(4-methylphenyl)sulfonylamino]-4-(4-morpholin-4-ylanilino)-4-oxobutanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CC(=O)O)C(=O)Nc2ccc(N3CCOCC3)cc2)cc1.Cc1ccc(S(=O)(=O)N[C@@H](CC(=O)O)C(=O)Nc2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/2C21H25N3O6S/c2*1-15-2-8-18(9-3-15)31(28,29)23-19(14-20(25)26)21(27)22-16-4-6-17(7-5-16)24-10-12-30-13-11-24/h2*2-9,19,23H,10-14H2,1H3,(H,22,27)(H,25,26)/t2*19-/m00/s1 |
| InChIKey | RSNUBKHZJZYZJV-KXSSUAHJSA-N |
| XLogP | 3.18 |
| TPSA | 250.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.03 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|