C56H62N10O14S2 — CID 159601767
(2S)-2-[(4-methylphenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)-N'-(4-nitrophenyl)pentanediamide (PubChem CID 159601767) has the molecular formula C56H62N10O14S2 and a molecular weight of 1163.30 g/mol. Its IUPAC name is (2S)-2-[(4-methylphenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)-N'-(4-nitrophenyl)pentanediamide.
| Compound Name | (2S)-2-[(4-methylphenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)-N'-(4-nitrophenyl)pentanediamide |
|---|---|
| PubChem CID | 159601767 |
| Molecular Formula | C56H62N10O14S2 |
| Molecular Weight | 1163.30 g/mol |
| Exact Mass | 1162.39 |
| IUPAC Name | (2S)-2-[(4-methylphenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)-N'-(4-nitrophenyl)pentanediamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CCC(=O)Nc2ccc([N+](=O)[O-])cc2)C(=O)Nc2ccc(N3CCOCC3)cc2)cc1.Cc1ccc(S(=O)(=O)N[C@@H](CCC(=O)Nc2ccc([N+](=O)[O-])cc2)C(=O)Nc2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/2C28H31N5O7S/c2*1-20-2-12-25(13-3-20)41(38,39)31-26(14-15-27(34)29-21-6-10-24(11-7-21)33(36)37)28(35)30-22-4-8-23(9-5-22)32-16-18-40-19-17-32/h2*2-13,26,31H,14-19H2,1H3,(H,29,34)(H,30,35)/t2*26-/m00/s1 |
| InChIKey | MLOKIOWANYBFHN-ZZTRQEOOSA-N |
| XLogP | 6.89 |
| TPSA | 319.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 82 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1163.30 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|