C21H25N5O6S — CID 24536331
2-[(4-methylphenyl)sulfonylamino]-N-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]acetamide (PubChem CID 24536331) has the molecular formula C21H25N5O6S and a molecular weight of 475.53 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylamino]-N-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]acetamide.
| Compound Name | 2-[(4-methylphenyl)sulfonylamino]-N-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 24536331 |
| Molecular Formula | C21H25N5O6S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylamino]-N-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)NCC(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)cc1 |
| InChI | InChI=1S/C21H25N5O6S/c1-16-2-8-19(9-3-16)33(31,32)23-14-20(27)22-15-21(28)25-12-10-24(11-13-25)17-4-6-18(7-5-17)26(29)30/h2-9,23H,10-15H2,1H3,(H,22,27) |
| InChIKey | BVGUBKKGQDQNRQ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 141.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|