C24H33N3O3S — CID 56557800
4-methyl-2-[(4-methylphenyl)sulfonylamino]-N-[4-(3-methylpyrrolidin-1-yl)phenyl]pentanamide (PubChem CID 56557800) has the molecular formula C24H33N3O3S and a molecular weight of 443.61 g/mol. Its IUPAC name is 4-methyl-2-[(4-methylphenyl)sulfonylamino]-N-[4-(3-methylpyrrolidin-1-yl)phenyl]pentanamide.
| Compound Name | 4-methyl-2-[(4-methylphenyl)sulfonylamino]-N-[4-(3-methylpyrrolidin-1-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 56557800 |
| Molecular Formula | C24H33N3O3S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 4-methyl-2-[(4-methylphenyl)sulfonylamino]-N-[4-(3-methylpyrrolidin-1-yl)phenyl]pentanamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CC(C)C)C(=O)Nc2ccc(N3CCC(C)C3)cc2)cc1 |
| InChI | InChI=1S/C24H33N3O3S/c1-17(2)15-23(26-31(29,30)22-11-5-18(3)6-12-22)24(28)25-20-7-9-21(10-8-20)27-14-13-19(4)16-27/h5-12,17,19,23,26H,13-16H2,1-4H3,(H,25,28) |
| InChIKey | WLWKSXKFSDRLNY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|