C20H33N3O3S — CID 30768113
(2R)-N-(1-ethylpiperidin-4-yl)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanamide (PubChem CID 30768113) has the molecular formula C20H33N3O3S and a molecular weight of 395.57 g/mol. Its IUPAC name is (2R)-N-(1-ethylpiperidin-4-yl)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanamide.
| Compound Name | (2R)-N-(1-ethylpiperidin-4-yl)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 30768113 |
| Molecular Formula | C20H33N3O3S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | (2R)-N-(1-ethylpiperidin-4-yl)-4-methyl-2-[(4-methylphenyl)sulfonylamino]pentanamide |
| SMILES | CCN1CCC(NC(=O)[C@@H](CC(C)C)NS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C20H33N3O3S/c1-5-23-12-10-17(11-13-23)21-20(24)19(14-15(2)3)22-27(25,26)18-8-6-16(4)7-9-18/h6-9,15,17,19,22H,5,10-14H2,1-4H3,(H,21,24)/t19-/m1/s1 |
| InChIKey | WZDPNNJXFZJSDT-LJQANCHMSA-N |
| XLogP | 2.29 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |