C22H31N3O3S — CID 42945663
N-(1-ethylpiperidin-4-yl)-3-methyl-2-(naphthalen-2-ylsulfonylamino)butanamide (PubChem CID 42945663) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is N-(1-ethylpiperidin-4-yl)-3-methyl-2-(naphthalen-2-ylsulfonylamino)butanamide.
| Compound Name | N-(1-ethylpiperidin-4-yl)-3-methyl-2-(naphthalen-2-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 42945663 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-(1-ethylpiperidin-4-yl)-3-methyl-2-(naphthalen-2-ylsulfonylamino)butanamide |
| SMILES | CCN1CCC(NC(=O)C(NS(=O)(=O)c2ccc3ccccc3c2)C(C)C)CC1 |
| InChI | InChI=1S/C22H31N3O3S/c1-4-25-13-11-19(12-14-25)23-22(26)21(16(2)3)24-29(27,28)20-10-9-17-7-5-6-8-18(17)15-20/h5-10,15-16,19,21,24H,4,11-14H2,1-3H3,(H,23,26) |
| InChIKey | VJNVZKCZOODMFE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |