C20H27N3O4S — CID 24642191
3-methyl-2-(naphthalen-2-ylsulfonylamino)-N-[2-oxo-2-(propylamino)ethyl]butanamide (PubChem CID 24642191) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is 3-methyl-2-(naphthalen-2-ylsulfonylamino)-N-[2-oxo-2-(propylamino)ethyl]butanamide.
| Compound Name | 3-methyl-2-(naphthalen-2-ylsulfonylamino)-N-[2-oxo-2-(propylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 24642191 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 3-methyl-2-(naphthalen-2-ylsulfonylamino)-N-[2-oxo-2-(propylamino)ethyl]butanamide |
| SMILES | CCCNC(=O)CNC(=O)C(NS(=O)(=O)c1ccc2ccccc2c1)C(C)C |
| InChI | InChI=1S/C20H27N3O4S/c1-4-11-21-18(24)13-22-20(25)19(14(2)3)23-28(26,27)17-10-9-15-7-5-6-8-16(15)12-17/h5-10,12,14,19,23H,4,11,13H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | BSEHBAQZGPYVCY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |