C22H24N2O4S — CID 18164733
3-methyl-2-(naphthalen-2-ylsulfonylamino)-N-phenylmethoxybutanamide (PubChem CID 18164733) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 3-methyl-2-(naphthalen-2-ylsulfonylamino)-N-phenylmethoxybutanamide.
| Compound Name | 3-methyl-2-(naphthalen-2-ylsulfonylamino)-N-phenylmethoxybutanamide |
|---|---|
| PubChem CID | 18164733 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 3-methyl-2-(naphthalen-2-ylsulfonylamino)-N-phenylmethoxybutanamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccc2ccccc2c1)C(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C22H24N2O4S/c1-16(2)21(22(25)23-28-15-17-8-4-3-5-9-17)24-29(26,27)20-13-12-18-10-6-7-11-19(18)14-20/h3-14,16,21,24H,15H2,1-2H3,(H,23,25) |
| InChIKey | HWYWWFNPNFHGFZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|