C17H22N2O4S — CID 30690800
(2R)-N-ethoxy-3-methyl-2-(naphthalen-2-ylsulfonylamino)butanamide (PubChem CID 30690800) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is (2R)-N-ethoxy-3-methyl-2-(naphthalen-2-ylsulfonylamino)butanamide.
| Compound Name | (2R)-N-ethoxy-3-methyl-2-(naphthalen-2-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 30690800 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (2R)-N-ethoxy-3-methyl-2-(naphthalen-2-ylsulfonylamino)butanamide |
| SMILES | CCONC(=O)[C@H](NS(=O)(=O)c1ccc2ccccc2c1)C(C)C |
| InChI | InChI=1S/C17H22N2O4S/c1-4-23-18-17(20)16(12(2)3)19-24(21,22)15-10-9-13-7-5-6-8-14(13)11-15/h5-12,16,19H,4H2,1-3H3,(H,18,20)/t16-/m1/s1 |
| InChIKey | WUEGHIJYVOITNP-MRXNPFEDSA-N |
| XLogP | 2.21 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|