C23H27N3O5S2 — CID 41312555
(2R)-3-methyl-2-(naphthalen-2-ylsulfonylamino)-N-[2-(4-sulfamoylphenyl)ethyl]butanamide (PubChem CID 41312555) has the molecular formula C23H27N3O5S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is (2R)-3-methyl-2-(naphthalen-2-ylsulfonylamino)-N-[2-(4-sulfamoylphenyl)ethyl]butanamide.
| Compound Name | (2R)-3-methyl-2-(naphthalen-2-ylsulfonylamino)-N-[2-(4-sulfamoylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 41312555 |
| Molecular Formula | C23H27N3O5S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | (2R)-3-methyl-2-(naphthalen-2-ylsulfonylamino)-N-[2-(4-sulfamoylphenyl)ethyl]butanamide |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1ccc2ccccc2c1)C(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C23H27N3O5S2/c1-16(2)22(23(27)25-14-13-17-7-10-20(11-8-17)32(24,28)29)26-33(30,31)21-12-9-18-5-3-4-6-19(18)15-21/h3-12,15-16,22,26H,13-14H2,1-2H3,(H,25,27)(H2,24,28,29)/t22-/m1/s1 |
| InChIKey | QSIHPWIMWALPDP-JOCHJYFZSA-N |
| XLogP | 2.15 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |