C29H30N4O5S — CID 155169057
(2S)-3-(1-formylindol-3-yl)-2-[(4-methylphenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 155169057) has the molecular formula C29H30N4O5S and a molecular weight of 546.65 g/mol. Its IUPAC name is (2S)-3-(1-formylindol-3-yl)-2-[(4-methylphenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | (2S)-3-(1-formylindol-3-yl)-2-[(4-methylphenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 155169057 |
| Molecular Formula | C29H30N4O5S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | (2S)-3-(1-formylindol-3-yl)-2-[(4-methylphenyl)sulfonylamino]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2cn(C=O)c3ccccc23)C(=O)Nc2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C29H30N4O5S/c1-21-6-12-25(13-7-21)39(36,37)31-27(18-22-19-33(20-34)28-5-3-2-4-26(22)28)29(35)30-23-8-10-24(11-9-23)32-14-16-38-17-15-32/h2-13,19-20,27,31H,14-18H2,1H3,(H,30,35)/t27-/m0/s1 |
| InChIKey | RYOYXSQJKCKODL-MHZLTWQESA-N |
| XLogP | 3.35 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|