C27H26F3N5O4S — CID 155168689
(2S)-3-(1H-indol-3-yl)-N-(4-morpholin-4-ylphenyl)-2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonylamino]propanamide (PubChem CID 155168689) has the molecular formula C27H26F3N5O4S and a molecular weight of 573.60 g/mol. Its IUPAC name is (2S)-3-(1H-indol-3-yl)-N-(4-morpholin-4-ylphenyl)-2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonylamino]propanamide.
| Compound Name | (2S)-3-(1H-indol-3-yl)-N-(4-morpholin-4-ylphenyl)-2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 155168689 |
| Molecular Formula | C27H26F3N5O4S |
| Molecular Weight | 573.60 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | (2S)-3-(1H-indol-3-yl)-N-(4-morpholin-4-ylphenyl)-2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonylamino]propanamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)[C@H](Cc1c[nH]c2ccccc12)NS(=O)(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C27H26F3N5O4S/c28-27(29,30)25-10-9-21(17-32-25)40(37,38)34-24(15-18-16-31-23-4-2-1-3-22(18)23)26(36)33-19-5-7-20(8-6-19)35-11-13-39-14-12-35/h1-10,16-17,24,31,34H,11-15H2,(H,33,36)/t24-/m0/s1 |
| InChIKey | NJLBRDPTNZBXLQ-DEOSSOPVSA-N |
| XLogP | 3.95 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|