C23H19FN4O5S — CID 71734196
(2R)-2-[[4-[(2-fluoropyridine-3-carbonyl)amino]phenyl]sulfonylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 71734196) has the molecular formula C23H19FN4O5S and a molecular weight of 482.49 g/mol. Its IUPAC name is (2R)-2-[[4-[(2-fluoropyridine-3-carbonyl)amino]phenyl]sulfonylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2R)-2-[[4-[(2-fluoropyridine-3-carbonyl)amino]phenyl]sulfonylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 71734196 |
| Molecular Formula | C23H19FN4O5S |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | (2R)-2-[[4-[(2-fluoropyridine-3-carbonyl)amino]phenyl]sulfonylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)O)cc1)c1cccnc1F |
| InChI | InChI=1S/C23H19FN4O5S/c24-21-18(5-3-11-25-21)22(29)27-15-7-9-16(10-8-15)34(32,33)28-20(23(30)31)12-14-13-26-19-6-2-1-4-17(14)19/h1-11,13,20,26,28H,12H2,(H,27,29)(H,30,31)/t20-/m1/s1 |
| InChIKey | HRNGMFYSJLHLOC-HXUWFJFHSA-N |
| XLogP | 2.93 |
| TPSA | 141.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|