C12H12F2N2O4S — CID 29276544
(2R)-2-(difluoromethylsulfonylamino)-3-(1H-indol-3-yl)propanoic acid (PubChem CID 29276544) has the molecular formula C12H12F2N2O4S and a molecular weight of 318.30 g/mol. Its IUPAC name is (2R)-2-(difluoromethylsulfonylamino)-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2R)-2-(difluoromethylsulfonylamino)-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 29276544 |
| Molecular Formula | C12H12F2N2O4S |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | (2R)-2-(difluoromethylsulfonylamino)-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1c[nH]c2ccccc12)NS(=O)(=O)C(F)F |
| InChI | InChI=1S/C12H12F2N2O4S/c13-12(14)21(19,20)16-10(11(17)18)5-7-6-15-9-4-2-1-3-8(7)9/h1-4,6,10,12,15-16H,5H2,(H,17,18)/t10-/m1/s1 |
| InChIKey | BJSFGISVEILWHZ-SNVBAGLBSA-N |
| XLogP | 1.31 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |