C18H22N4O5S — CID 121437071
[1-(but-3-enylamino)-3-[1-(4-methylphenyl)sulfonylimidazol-4-yl]-1-oxopropan-2-yl]carbamic acid (PubChem CID 121437071) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is [1-(but-3-enylamino)-3-[1-(4-methylphenyl)sulfonylimidazol-4-yl]-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [1-(but-3-enylamino)-3-[1-(4-methylphenyl)sulfonylimidazol-4-yl]-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 121437071 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [1-(but-3-enylamino)-3-[1-(4-methylphenyl)sulfonylimidazol-4-yl]-1-oxopropan-2-yl]carbamic acid |
| SMILES | C=CCCNC(=O)C(Cc1cn(S(=O)(=O)c2ccc(C)cc2)cn1)NC(=O)O |
| InChI | InChI=1S/C18H22N4O5S/c1-3-4-9-19-17(23)16(21-18(24)25)10-14-11-22(12-20-14)28(26,27)15-7-5-13(2)6-8-15/h3,5-8,11-12,16,21H,1,4,9-10H2,2H3,(H,19,23)(H,24,25) |
| InChIKey | YKGWLCYMCATVDZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|