C11H10N2O4S — CID 26967023
1-(4-methylphenyl)sulfonylimidazole-4-carboxylic acid (PubChem CID 26967023) has the molecular formula C11H10N2O4S and a molecular weight of 266.28 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonylimidazole-4-carboxylic acid.
| Compound Name | 1-(4-methylphenyl)sulfonylimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 26967023 |
| Molecular Formula | C11H10N2O4S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 1-(4-methylphenyl)sulfonylimidazole-4-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)n2cnc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C11H10N2O4S/c1-8-2-4-9(5-3-8)18(16,17)13-6-10(11(14)15)12-7-13/h2-7H,1H3,(H,14,15) |
| InChIKey | KEHGFYXOUGMVJB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |