About azane;1-(4-methylphenyl)sulfonylimidazole
azane;1-(4-methylphenyl)sulfonylimidazole (PubChem CID 174813676) has the molecular formula C10H13N3O2S
and a molecular weight of 239.30 g/mol. Its IUPAC name is azane;1-(4-methylphenyl)sulfonylimidazole.
Molecular Properties
| Compound Name | azane;1-(4-methylphenyl)sulfonylimidazole |
| PubChem CID | 174813676 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | azane;1-(4-methylphenyl)sulfonylimidazole |
| SMILES | Cc1ccc(S(=O)(=O)n2ccnc2)cc1.N |
| InChI | InChI=1S/C10H10N2O2S.H3N/c1-9-2-4-10(5-3-9)15(13,14)12-7-6-11-8-12;/h2-8H,1H3;1H3 |
| InChIKey | FYYGSGUMLBFWER-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azane;1-(4-methylphenyl)sulfonylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-(4-methylphenyl)sulfonylimidazole?
The IUPAC name of azane;1-(4-methylphenyl)sulfonylimidazole (CID 174813676) is azane;1-(4-methylphenyl)sulfonylimidazole.
What is the SMILES notation for azane;1-(4-methylphenyl)sulfonylimidazole?
The canonical SMILES for azane;1-(4-methylphenyl)sulfonylimidazole is Cc1ccc(S(=O)(=O)n2ccnc2)cc1.N.
What is the InChIKey of azane;1-(4-methylphenyl)sulfonylimidazole?
The InChIKey is FYYGSGUMLBFWER-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S.H3N/c1-9-2-4-10(5-3-9)15(13,14)12-7-6-11-8-12;/h2-8H,1H3;1H3.
What are the key properties of azane;1-(4-methylphenyl)sulfonylimidazole?
azane;1-(4-methylphenyl)sulfonylimidazole has a molecular weight of 239.30 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-(4-methylphenyl)sulfonylimidazole is sourced from PubChem (CID 174813676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).