C25H24ClN3O6S — CID 4841701
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-[(4-chlorophenyl)sulfonylamino]benzoate (PubChem CID 4841701) has the molecular formula C25H24ClN3O6S and a molecular weight of 530.00 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-[(4-chlorophenyl)sulfonylamino]benzoate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-[(4-chlorophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 4841701 |
| Molecular Formula | C25H24ClN3O6S |
| Molecular Weight | 530.00 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-[(4-chlorophenyl)sulfonylamino]benzoate |
| SMILES | O=C(COC(=O)c1ccccc1NS(=O)(=O)c1ccc(Cl)cc1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H24ClN3O6S/c26-18-5-11-21(12-6-18)36(32,33)28-23-4-2-1-3-22(23)25(31)35-17-24(30)27-19-7-9-20(10-8-19)29-13-15-34-16-14-29/h1-12,28H,13-17H2,(H,27,30) |
| InChIKey | AHUKAAWDVPYTBO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.00 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|