C22H26N4O4 — CID 17419831
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-pyrrolidin-1-ylpyridine-3-carboxylate (PubChem CID 17419831) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-pyrrolidin-1-ylpyridine-3-carboxylate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-pyrrolidin-1-ylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 17419831 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-pyrrolidin-1-ylpyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1cccnc1N1CCCC1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H26N4O4/c27-20(24-17-5-7-18(8-6-17)25-12-14-29-15-13-25)16-30-22(28)19-4-3-9-23-21(19)26-10-1-2-11-26/h3-9H,1-2,10-16H2,(H,24,27) |
| InChIKey | QILMLLPMDVYUOS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|