C15H18N4O7S — CID 18753506
4-(2,4-dioxo-1H-pyrimidin-3-yl)-N-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]butanamide (PubChem CID 18753506) has the molecular formula C15H18N4O7S and a molecular weight of 398.40 g/mol. Its IUPAC name is 4-(2,4-dioxo-1H-pyrimidin-3-yl)-N-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]butanamide.
| Compound Name | 4-(2,4-dioxo-1H-pyrimidin-3-yl)-N-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 18753506 |
| Molecular Formula | C15H18N4O7S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 4-(2,4-dioxo-1H-pyrimidin-3-yl)-N-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]butanamide |
| SMILES | COc1ccc(S(=O)(=O)NC(CCn2c(=O)cc[nH]c2=O)C(=O)NO)cc1 |
| InChI | InChI=1S/C15H18N4O7S/c1-26-10-2-4-11(5-3-10)27(24,25)18-12(14(21)17-23)7-9-19-13(20)6-8-16-15(19)22/h2-6,8,12,18,23H,7,9H2,1H3,(H,16,22)(H,17,21) |
| InChIKey | NWUPQIGFGDKERU-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 159.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|