C16H24N2O6S — CID 22907030
methyl 2-[(4-methoxyphenyl)sulfonylamino]-4-morpholin-4-ylbutanoate (PubChem CID 22907030) has the molecular formula C16H24N2O6S and a molecular weight of 372.44 g/mol. Its IUPAC name is methyl 2-[(4-methoxyphenyl)sulfonylamino]-4-morpholin-4-ylbutanoate.
| Compound Name | methyl 2-[(4-methoxyphenyl)sulfonylamino]-4-morpholin-4-ylbutanoate |
|---|---|
| PubChem CID | 22907030 |
| Molecular Formula | C16H24N2O6S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | methyl 2-[(4-methoxyphenyl)sulfonylamino]-4-morpholin-4-ylbutanoate |
| SMILES | COC(=O)C(CCN1CCOCC1)NS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H24N2O6S/c1-22-13-3-5-14(6-4-13)25(20,21)17-15(16(19)23-2)7-8-18-9-11-24-12-10-18/h3-6,15,17H,7-12H2,1-2H3 |
| InChIKey | YASRZYMEWOHJOI-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |