C24H28N2O6S — CID 10552402
methyl 2-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]-6-morpholin-4-ylhex-4-ynoate (PubChem CID 10552402) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is methyl 2-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]-6-morpholin-4-ylhex-4-ynoate.
| Compound Name | methyl 2-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]-6-morpholin-4-ylhex-4-ynoate |
|---|---|
| PubChem CID | 10552402 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | methyl 2-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]-6-morpholin-4-ylhex-4-ynoate |
| SMILES | COC(=O)C(CC#CCN1CCOCC1)NS(=O)(=O)c1ccc(-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H28N2O6S/c1-30-21-10-6-19(7-11-21)20-8-12-22(13-9-20)33(28,29)25-23(24(27)31-2)5-3-4-14-26-15-17-32-18-16-26/h6-13,23,25H,5,14-18H2,1-2H3 |
| InChIKey | SAVBBICYWOCWHS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|