C25H23NO4S2 — CID 10552138
methyl 2-[[4-(4-methylsulfanylphenyl)phenyl]sulfonylamino]-5-phenylpent-4-ynoate (PubChem CID 10552138) has the molecular formula C25H23NO4S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is methyl 2-[[4-(4-methylsulfanylphenyl)phenyl]sulfonylamino]-5-phenylpent-4-ynoate.
| Compound Name | methyl 2-[[4-(4-methylsulfanylphenyl)phenyl]sulfonylamino]-5-phenylpent-4-ynoate |
|---|---|
| PubChem CID | 10552138 |
| Molecular Formula | C25H23NO4S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | methyl 2-[[4-(4-methylsulfanylphenyl)phenyl]sulfonylamino]-5-phenylpent-4-ynoate |
| SMILES | COC(=O)C(CC#Cc1ccccc1)NS(=O)(=O)c1ccc(-c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C25H23NO4S2/c1-30-25(27)24(10-6-9-19-7-4-3-5-8-19)26-32(28,29)23-17-13-21(14-18-23)20-11-15-22(31-2)16-12-20/h3-5,7-8,11-18,24,26H,10H2,1-2H3 |
| InChIKey | QBWGLQLNYKJZFV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|