C27H27N3O5S — CID 21252908
methyl 5-phenyl-2-[[4-[(5-propylpyridine-2-carbonyl)amino]phenyl]sulfonylamino]pent-4-ynoate (PubChem CID 21252908) has the molecular formula C27H27N3O5S and a molecular weight of 505.60 g/mol. Its IUPAC name is methyl 5-phenyl-2-[[4-[(5-propylpyridine-2-carbonyl)amino]phenyl]sulfonylamino]pent-4-ynoate.
| Compound Name | methyl 5-phenyl-2-[[4-[(5-propylpyridine-2-carbonyl)amino]phenyl]sulfonylamino]pent-4-ynoate |
|---|---|
| PubChem CID | 21252908 |
| Molecular Formula | C27H27N3O5S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | methyl 5-phenyl-2-[[4-[(5-propylpyridine-2-carbonyl)amino]phenyl]sulfonylamino]pent-4-ynoate |
| SMILES | CCCc1ccc(C(=O)Nc2ccc(S(=O)(=O)NC(CC#Cc3ccccc3)C(=O)OC)cc2)nc1 |
| InChI | InChI=1S/C27H27N3O5S/c1-3-8-21-13-18-24(28-19-21)26(31)29-22-14-16-23(17-15-22)36(33,34)30-25(27(32)35-2)12-7-11-20-9-5-4-6-10-20/h4-6,9-10,13-19,25,30H,3,8,12H2,1-2H3,(H,29,31) |
| InChIKey | VLKFGVZHZJOBDG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|