C25H20F3N3O6S — CID 21253003
6-phenoxy-2-[[4-[[6-(trifluoromethyl)pyridine-3-carbonyl]amino]phenyl]sulfonylamino]hex-4-ynoic acid (PubChem CID 21253003) has the molecular formula C25H20F3N3O6S and a molecular weight of 547.51 g/mol. Its IUPAC name is 6-phenoxy-2-[[4-[[6-(trifluoromethyl)pyridine-3-carbonyl]amino]phenyl]sulfonylamino]hex-4-ynoic acid.
| Compound Name | 6-phenoxy-2-[[4-[[6-(trifluoromethyl)pyridine-3-carbonyl]amino]phenyl]sulfonylamino]hex-4-ynoic acid |
|---|---|
| PubChem CID | 21253003 |
| Molecular Formula | C25H20F3N3O6S |
| Molecular Weight | 547.51 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 6-phenoxy-2-[[4-[[6-(trifluoromethyl)pyridine-3-carbonyl]amino]phenyl]sulfonylamino]hex-4-ynoic acid |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NC(CC#CCOc2ccccc2)C(=O)O)cc1)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C25H20F3N3O6S/c26-25(27,28)22-14-9-17(16-29-22)23(32)30-18-10-12-20(13-11-18)38(35,36)31-21(24(33)34)8-4-5-15-37-19-6-2-1-3-7-19/h1-3,6-7,9-14,16,21,31H,8,15H2,(H,30,32)(H,33,34) |
| InChIKey | NSRLHVPBLIDRQA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|