C20H24N2O6S — CID 22456298
2-[(4-benzamidophenyl)sulfonylamino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid (PubChem CID 22456298) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is 2-[(4-benzamidophenyl)sulfonylamino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid.
| Compound Name | 2-[(4-benzamidophenyl)sulfonylamino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
|---|---|
| PubChem CID | 22456298 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-[(4-benzamidophenyl)sulfonylamino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
| SMILES | CC(C)(C)OCC(NS(=O)(=O)c1ccc(NC(=O)c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C20H24N2O6S/c1-20(2,3)28-13-17(19(24)25)22-29(26,27)16-11-9-15(10-12-16)21-18(23)14-7-5-4-6-8-14/h4-12,17,22H,13H2,1-3H3,(H,21,23)(H,24,25) |
| InChIKey | NXAIJBKCIRNHAH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |