C29H28N4O6S2 — CID 171980397
N-[4-[[[2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]sulfamoyl]phenyl]benzamide (PubChem CID 171980397) has the molecular formula C29H28N4O6S2 and a molecular weight of 592.70 g/mol. Its IUPAC name is N-[4-[[[2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]sulfamoyl]phenyl]benzamide.
| Compound Name | N-[4-[[[2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 171980397 |
| Molecular Formula | C29H28N4O6S2 |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | N-[4-[[[2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl]amino]sulfamoyl]phenyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)NNS(=O)(=O)c2ccc(NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H28N4O6S2/c1-21-12-16-25(17-13-21)40(36,37)32-27(20-22-8-4-2-5-9-22)29(35)31-33-41(38,39)26-18-14-24(15-19-26)30-28(34)23-10-6-3-7-11-23/h2-19,27,32-33H,20H2,1H3,(H,30,34)(H,31,35) |
| InChIKey | GBBAAKMWFDUOEO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|