C23H24N4O3S2 — CID 139248529
1-[[(2R)-2-(benzenesulfonamido)-3-phenylpropanoyl]amino]-3-(4-methylphenyl)thiourea (PubChem CID 139248529) has the molecular formula C23H24N4O3S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 1-[[(2R)-2-(benzenesulfonamido)-3-phenylpropanoyl]amino]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[[(2R)-2-(benzenesulfonamido)-3-phenylpropanoyl]amino]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 139248529 |
| Molecular Formula | C23H24N4O3S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 1-[[(2R)-2-(benzenesulfonamido)-3-phenylpropanoyl]amino]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NNC(=O)[C@@H](Cc2ccccc2)NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N4O3S2/c1-17-12-14-19(15-13-17)24-23(31)26-25-22(28)21(16-18-8-4-2-5-9-18)27-32(29,30)20-10-6-3-7-11-20/h2-15,21,27H,16H2,1H3,(H,25,28)(H2,24,26,31)/t21-/m1/s1 |
| InChIKey | RALXYNKPTWOLLC-OAQYLSRUSA-N |
| XLogP | 2.90 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|