C22H21IN4O3S2 — CID 139248541
1-[[(2S)-2-(benzenesulfonamido)-3-phenylpropanoyl]amino]-3-(4-iodophenyl)thiourea (PubChem CID 139248541) has the molecular formula C22H21IN4O3S2 and a molecular weight of 580.47 g/mol. Its IUPAC name is 1-[[(2S)-2-(benzenesulfonamido)-3-phenylpropanoyl]amino]-3-(4-iodophenyl)thiourea.
| Compound Name | 1-[[(2S)-2-(benzenesulfonamido)-3-phenylpropanoyl]amino]-3-(4-iodophenyl)thiourea |
|---|---|
| PubChem CID | 139248541 |
| Molecular Formula | C22H21IN4O3S2 |
| Molecular Weight | 580.47 g/mol |
| Exact Mass | 580.01 |
| IUPAC Name | 1-[[(2S)-2-(benzenesulfonamido)-3-phenylpropanoyl]amino]-3-(4-iodophenyl)thiourea |
| SMILES | O=C(NNC(=S)Nc1ccc(I)cc1)[C@H](Cc1ccccc1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H21IN4O3S2/c23-17-11-13-18(14-12-17)24-22(31)26-25-21(28)20(15-16-7-3-1-4-8-16)27-32(29,30)19-9-5-2-6-10-19/h1-14,20,27H,15H2,(H,25,28)(H2,24,26,31)/t20-/m0/s1 |
| InChIKey | WMNMOAALANHLHT-FQEVSTJZSA-N |
| XLogP | 3.20 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|