C29H31IN2O3S — CID 126338622
(2R)-N-[4-(1-bicyclo[2.2.2]octanyl)phenyl]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 126338622) has the molecular formula C29H31IN2O3S and a molecular weight of 614.55 g/mol. Its IUPAC name is (2R)-N-[4-(1-bicyclo[2.2.2]octanyl)phenyl]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (2R)-N-[4-(1-bicyclo[2.2.2]octanyl)phenyl]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126338622 |
| Molecular Formula | C29H31IN2O3S |
| Molecular Weight | 614.55 g/mol |
| Exact Mass | 614.11 |
| IUPAC Name | (2R)-N-[4-(1-bicyclo[2.2.2]octanyl)phenyl]-2-[(4-iodophenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | O=C(Nc1ccc(C23CCC(CC2)CC3)cc1)[C@@H](Cc1ccccc1)NS(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C29H31IN2O3S/c30-24-8-12-26(13-9-24)36(34,35)32-27(20-22-4-2-1-3-5-22)28(33)31-25-10-6-23(7-11-25)29-17-14-21(15-18-29)16-19-29/h1-13,21,27,32H,14-20H2,(H,31,33)/t21?,27-,29?/m1/s1 |
| InChIKey | FTFVKADEVSQUPZ-PWKJKTQUSA-N |
| XLogP | 6.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|