C20H23IN2O4S — CID 126338611
(2R)-2-[(4-iodophenyl)sulfonylamino]-N-[[(2S)-oxolan-2-yl]methyl]-3-phenylpropanamide (PubChem CID 126338611) has the molecular formula C20H23IN2O4S and a molecular weight of 514.39 g/mol. Its IUPAC name is (2R)-2-[(4-iodophenyl)sulfonylamino]-N-[[(2S)-oxolan-2-yl]methyl]-3-phenylpropanamide.
| Compound Name | (2R)-2-[(4-iodophenyl)sulfonylamino]-N-[[(2S)-oxolan-2-yl]methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 126338611 |
| Molecular Formula | C20H23IN2O4S |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | (2R)-2-[(4-iodophenyl)sulfonylamino]-N-[[(2S)-oxolan-2-yl]methyl]-3-phenylpropanamide |
| SMILES | O=C(NC[C@@H]1CCCO1)[C@@H](Cc1ccccc1)NS(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C20H23IN2O4S/c21-16-8-10-18(11-9-16)28(25,26)23-19(13-15-5-2-1-3-6-15)20(24)22-14-17-7-4-12-27-17/h1-3,5-6,8-11,17,19,23H,4,7,12-14H2,(H,22,24)/t17-,19+/m0/s1 |
| InChIKey | FLEHXMBXIQRSEF-PKOBYXMFSA-N |
| XLogP | 2.48 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|